C14H11Cl3O2 — CID 10686994
3,5-dichloro-4-[2-(2-chloro-4-hydroxyphenyl)ethyl]phenol (PubChem CID 10686994) has the molecular formula C14H11Cl3O2 and a molecular weight of 317.60 g/mol. Its IUPAC name is 3,5-dichloro-4-[2-(2-chloro-4-hydroxyphenyl)ethyl]phenol.
| Compound Name | 3,5-dichloro-4-[2-(2-chloro-4-hydroxyphenyl)ethyl]phenol |
|---|---|
| PubChem CID | 10686994 |
| Molecular Formula | C14H11Cl3O2 |
| Molecular Weight | 317.60 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | 3,5-dichloro-4-[2-(2-chloro-4-hydroxyphenyl)ethyl]phenol |
| SMILES | Oc1ccc(CCc2c(Cl)cc(O)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H11Cl3O2/c15-12-5-9(18)3-1-8(12)2-4-11-13(16)6-10(19)7-14(11)17/h1,3,5-7,18-19H,2,4H2 |
| InChIKey | RIYLSNJLNAINED-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.60 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |