C15H13Cl3O2 — CID 101118969
3,5-dichloro-4-[2-(2-chloro-3-methoxyphenyl)ethyl]phenol (PubChem CID 101118969) has the molecular formula C15H13Cl3O2 and a molecular weight of 331.63 g/mol. Its IUPAC name is 3,5-dichloro-4-[2-(2-chloro-3-methoxyphenyl)ethyl]phenol.
| Compound Name | 3,5-dichloro-4-[2-(2-chloro-3-methoxyphenyl)ethyl]phenol |
|---|---|
| PubChem CID | 101118969 |
| Molecular Formula | C15H13Cl3O2 |
| Molecular Weight | 331.63 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 3,5-dichloro-4-[2-(2-chloro-3-methoxyphenyl)ethyl]phenol |
| SMILES | COc1cccc(CCc2c(Cl)cc(O)cc2Cl)c1Cl |
| InChI | InChI=1S/C15H13Cl3O2/c1-20-14-4-2-3-9(15(14)18)5-6-11-12(16)7-10(19)8-13(11)17/h2-4,7-8,19H,5-6H2,1H3 |
| InChIKey | JHNFRGFBNRWUIG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.63 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |