C14H10Cl4 — CID 173469759
1,4-dichloro-2-[2-(2,4-dichlorophenyl)ethyl]benzene (PubChem CID 173469759) has the molecular formula C14H10Cl4 and a molecular weight of 320.05 g/mol. Its IUPAC name is 1,4-dichloro-2-[2-(2,4-dichlorophenyl)ethyl]benzene.
| Compound Name | 1,4-dichloro-2-[2-(2,4-dichlorophenyl)ethyl]benzene |
|---|---|
| PubChem CID | 173469759 |
| Molecular Formula | C14H10Cl4 |
| Molecular Weight | 320.05 g/mol |
| Exact Mass | 317.95 |
| IUPAC Name | 1,4-dichloro-2-[2-(2,4-dichlorophenyl)ethyl]benzene |
| SMILES | Clc1ccc(CCc2cc(Cl)ccc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H10Cl4/c15-11-5-6-13(17)10(7-11)2-1-9-3-4-12(16)8-14(9)18/h3-8H,1-2H2 |
| InChIKey | MFYMIORQCPORLM-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.05 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |