C10H9Cl3 — CID 24722005
1,4-dichloro-2-(3-chlorobut-3-enyl)benzene (PubChem CID 24722005) has the molecular formula C10H9Cl3 and a molecular weight of 235.54 g/mol. Its IUPAC name is 1,4-dichloro-2-(3-chlorobut-3-enyl)benzene.
| Compound Name | 1,4-dichloro-2-(3-chlorobut-3-enyl)benzene |
|---|---|
| PubChem CID | 24722005 |
| Molecular Formula | C10H9Cl3 |
| Molecular Weight | 235.54 g/mol |
| Exact Mass | 233.98 |
| IUPAC Name | 1,4-dichloro-2-(3-chlorobut-3-enyl)benzene |
| SMILES | C=C(Cl)CCc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H9Cl3/c1-7(11)2-3-8-6-9(12)4-5-10(8)13/h4-6H,1-3H2 |
| InChIKey | UKMQPBJUGKHHKH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.54 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |