C7H5Cl2F — CID 175609206
1,4-dichloro-2-(fluoromethyl)benzene (PubChem CID 175609206) has the molecular formula C7H5Cl2F and a molecular weight of 179.02 g/mol. Its IUPAC name is 1,4-dichloro-2-(fluoromethyl)benzene.
| Compound Name | 1,4-dichloro-2-(fluoromethyl)benzene |
|---|---|
| PubChem CID | 175609206 |
| Molecular Formula | C7H5Cl2F |
| Molecular Weight | 179.02 g/mol |
| Exact Mass | 177.98 |
| IUPAC Name | 1,4-dichloro-2-(fluoromethyl)benzene |
| SMILES | FCc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C7H5Cl2F/c8-6-1-2-7(9)5(3-6)4-10/h1-3H,4H2 |
| InChIKey | XEHNHPAWYRWVLK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.02 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |