C13H11Cl2N — CID 21272493
4-[(2,5-dichlorophenyl)methyl]aniline (PubChem CID 21272493) has the molecular formula C13H11Cl2N and a molecular weight of 252.14 g/mol. Its IUPAC name is 4-[(2,5-dichlorophenyl)methyl]aniline.
| Compound Name | 4-[(2,5-dichlorophenyl)methyl]aniline |
|---|---|
| PubChem CID | 21272493 |
| Molecular Formula | C13H11Cl2N |
| Molecular Weight | 252.14 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 4-[(2,5-dichlorophenyl)methyl]aniline |
| SMILES | Nc1ccc(Cc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C13H11Cl2N/c14-11-3-6-13(15)10(8-11)7-9-1-4-12(16)5-2-9/h1-6,8H,7,16H2 |
| InChIKey | USOXDKRRYBZBFJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.14 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|