C13H16N4 — CID 101277573
5-[(4-aminophenyl)methyl]benzene-1,2,4-triamine (PubChem CID 101277573) has the molecular formula C13H16N4 and a molecular weight of 228.30 g/mol. Its IUPAC name is 5-[(4-aminophenyl)methyl]benzene-1,2,4-triamine.
| Compound Name | 5-[(4-aminophenyl)methyl]benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 101277573 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 5-[(4-aminophenyl)methyl]benzene-1,2,4-triamine |
| SMILES | Nc1ccc(Cc2cc(N)c(N)cc2N)cc1 |
| InChI | InChI=1S/C13H16N4/c14-10-3-1-8(2-4-10)5-9-6-12(16)13(17)7-11(9)15/h1-4,6-7H,5,14-17H2 |
| InChIKey | NTZCIKWMWOTNPI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|