C10H12ClNO3 — CID 174797793
(2R)-2-amino-4-(2-chloro-4-hydroxyphenyl)butanoic acid (PubChem CID 174797793) has the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. Its IUPAC name is (2R)-2-amino-4-(2-chloro-4-hydroxyphenyl)butanoic acid.
| Compound Name | (2R)-2-amino-4-(2-chloro-4-hydroxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 174797793 |
| Molecular Formula | C10H12ClNO3 |
| Molecular Weight | 229.66 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | (2R)-2-amino-4-(2-chloro-4-hydroxyphenyl)butanoic acid |
| SMILES | N[C@H](CCc1ccc(O)cc1Cl)C(=O)O |
| InChI | InChI=1S/C10H12ClNO3/c11-8-5-7(13)3-1-6(8)2-4-9(12)10(14)15/h1,3,5,9,13H,2,4,12H2,(H,14,15)/t9-/m1/s1 |
| InChIKey | NCHFAAFFPNDLOK-SECBINFHSA-N |
| XLogP | 1.39 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.66 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |