C10H10ClF2NO2 — CID 171702806
(2R)-2-amino-4-(3-chloro-2,4-difluorophenyl)butanoic acid (PubChem CID 171702806) has the molecular formula C10H10ClF2NO2 and a molecular weight of 249.64 g/mol. Its IUPAC name is (2R)-2-amino-4-(3-chloro-2,4-difluorophenyl)butanoic acid.
| Compound Name | (2R)-2-amino-4-(3-chloro-2,4-difluorophenyl)butanoic acid |
|---|---|
| PubChem CID | 171702806 |
| Molecular Formula | C10H10ClF2NO2 |
| Molecular Weight | 249.64 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | (2R)-2-amino-4-(3-chloro-2,4-difluorophenyl)butanoic acid |
| SMILES | N[C@H](CCc1ccc(F)c(Cl)c1F)C(=O)O |
| InChI | InChI=1S/C10H10ClF2NO2/c11-8-6(12)3-1-5(9(8)13)2-4-7(14)10(15)16/h1,3,7H,2,4,14H2,(H,15,16)/t7-/m1/s1 |
| InChIKey | DDKDUTXIYQOJFP-SSDOTTSWSA-N |
| XLogP | 1.96 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.64 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|