About (2S)-2-aminopentanedioic acid;4-chloroaniline
(2S)-2-aminopentanedioic acid;4-chloroaniline (PubChem CID 70375462) has the molecular formula C11H15ClN2O4
and a molecular weight of 274.70 g/mol. Its IUPAC name is (2S)-2-aminopentanedioic acid;4-chloroaniline.
Molecular Properties
| Compound Name | (2S)-2-aminopentanedioic acid;4-chloroaniline |
| PubChem CID | 70375462 |
| Molecular Formula | C11H15ClN2O4 |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | (2S)-2-aminopentanedioic acid;4-chloroaniline |
| SMILES | N[C@@H](CCC(=O)O)C(=O)O.Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C6H6ClN.C5H9NO4/c7-5-1-3-6(8)4-2-5;6-3(5(9)10)1-2-4(7)8/h1-4H,8H2;3H,1-2,6H2,(H,7,8)(H,9,10)/t;3-/m.0/s1 |
| InChIKey | NDOGKIPILOWZJX-HVDRVSQOSA-N |
| XLogP | 1.19 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-aminopentanedioic acid;4-chloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminopentanedioic acid;4-chloroaniline?
The IUPAC name of (2S)-2-aminopentanedioic acid;4-chloroaniline (CID 70375462) is (2S)-2-aminopentanedioic acid;4-chloroaniline.
What is the SMILES notation for (2S)-2-aminopentanedioic acid;4-chloroaniline?
The canonical SMILES for (2S)-2-aminopentanedioic acid;4-chloroaniline is N[C@@H](CCC(=O)O)C(=O)O.Nc1ccc(Cl)cc1.
What is the InChIKey of (2S)-2-aminopentanedioic acid;4-chloroaniline?
The InChIKey is NDOGKIPILOWZJX-HVDRVSQOSA-N. The full InChI is InChI=1S/C6H6ClN.C5H9NO4/c7-5-1-3-6(8)4-2-5;6-3(5(9)10)1-2-4(7)8/h1-4H,8H2;3H,1-2,6H2,(H,7,8)(H,9,10)/t;3-/m.0/s1.
What are the key properties of (2S)-2-aminopentanedioic acid;4-chloroaniline?
(2S)-2-aminopentanedioic acid;4-chloroaniline has a molecular weight of 274.70 g/mol, XLogP of 1.19, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminopentanedioic acid;4-chloroaniline is sourced from PubChem (CID 70375462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).