C9H8F2INO2 — CID 90411427
(2S)-2-amino-3-(2,4-difluoro-3-iodophenyl)propanoic acid (PubChem CID 90411427) has the molecular formula C9H8F2INO2 and a molecular weight of 327.07 g/mol. Its IUPAC name is (2S)-2-amino-3-(2,4-difluoro-3-iodophenyl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(2,4-difluoro-3-iodophenyl)propanoic acid |
|---|---|
| PubChem CID | 90411427 |
| Molecular Formula | C9H8F2INO2 |
| Molecular Weight | 327.07 g/mol |
| Exact Mass | 326.96 |
| IUPAC Name | (2S)-2-amino-3-(2,4-difluoro-3-iodophenyl)propanoic acid |
| SMILES | N[C@@H](Cc1ccc(F)c(I)c1F)C(=O)O |
| InChI | InChI=1S/C9H8F2INO2/c10-5-2-1-4(7(11)8(5)12)3-6(13)9(14)15/h1-2,6H,3,13H2,(H,14,15)/t6-/m0/s1 |
| InChIKey | PAZHUTHKWLBJTG-LURJTMIESA-N |
| XLogP | 1.52 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.07 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|