C10H12FNO3S — CID 117364576
2-amino-3-(2-fluoro-4-hydroxy-3-methylsulfanylphenyl)propanoic acid (PubChem CID 117364576) has the molecular formula C10H12FNO3S and a molecular weight of 245.27 g/mol. Its IUPAC name is 2-amino-3-(2-fluoro-4-hydroxy-3-methylsulfanylphenyl)propanoic acid.
| Compound Name | 2-amino-3-(2-fluoro-4-hydroxy-3-methylsulfanylphenyl)propanoic acid |
|---|---|
| PubChem CID | 117364576 |
| Molecular Formula | C10H12FNO3S |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2-amino-3-(2-fluoro-4-hydroxy-3-methylsulfanylphenyl)propanoic acid |
| SMILES | CSc1c(O)ccc(CC(N)C(=O)O)c1F |
| InChI | InChI=1S/C10H12FNO3S/c1-16-9-7(13)3-2-5(8(9)11)4-6(12)10(14)15/h2-3,6,13H,4,12H2,1H3,(H,14,15) |
| InChIKey | ZUOADJZDVGSMIE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |