C10H10FN3O — CID 166492561
3-(5-fluoro-2-methoxyphenyl)-1-methyl-1,2,4-triazole (PubChem CID 166492561) has the molecular formula C10H10FN3O and a molecular weight of 207.21 g/mol. Its IUPAC name is 3-(5-fluoro-2-methoxyphenyl)-1-methyl-1,2,4-triazole.
| Compound Name | 3-(5-fluoro-2-methoxyphenyl)-1-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 166492561 |
| Molecular Formula | C10H10FN3O |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 3-(5-fluoro-2-methoxyphenyl)-1-methyl-1,2,4-triazole |
| SMILES | COc1ccc(F)cc1-c1ncn(C)n1 |
| InChI | InChI=1S/C10H10FN3O/c1-14-6-12-10(13-14)8-5-7(11)3-4-9(8)15-2/h3-6H,1-2H3 |
| InChIKey | LAVSILALIJXDEV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |