C10H8FNOS — CID 4984858
4-(5-fluoro-2-methoxyphenyl)-1,3-thiazole (PubChem CID 4984858) has the molecular formula C10H8FNOS and a molecular weight of 209.25 g/mol. Its IUPAC name is 4-(5-fluoro-2-methoxyphenyl)-1,3-thiazole.
| Compound Name | 4-(5-fluoro-2-methoxyphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 4984858 |
| Molecular Formula | C10H8FNOS |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 4-(5-fluoro-2-methoxyphenyl)-1,3-thiazole |
| SMILES | COc1ccc(F)cc1-c1cscn1 |
| InChI | InChI=1S/C10H8FNOS/c1-13-10-3-2-7(11)4-8(10)9-5-14-6-12-9/h2-6H,1H3 |
| InChIKey | CDNDTAMNQHUENN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |