C9H6FNOS — CID 97033771
4-fluoro-2-(1,3-thiazol-4-yl)phenol (PubChem CID 97033771) has the molecular formula C9H6FNOS and a molecular weight of 195.22 g/mol. Its IUPAC name is 4-fluoro-2-(1,3-thiazol-4-yl)phenol.
| Compound Name | 4-fluoro-2-(1,3-thiazol-4-yl)phenol |
|---|---|
| PubChem CID | 97033771 |
| Molecular Formula | C9H6FNOS |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | 4-fluoro-2-(1,3-thiazol-4-yl)phenol |
| SMILES | Oc1ccc(F)cc1-c1cscn1 |
| InChI | InChI=1S/C9H6FNOS/c10-6-1-2-9(12)7(3-6)8-4-13-5-11-8/h1-5,12H |
| InChIKey | FRNRLTSGOQVABL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |