C9H5Cl2NS — CID 4009904
4-(2,4-dichlorophenyl)-1,3-thiazole (PubChem CID 4009904) has the molecular formula C9H5Cl2NS and a molecular weight of 230.12 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-1,3-thiazole.
| Compound Name | 4-(2,4-dichlorophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 4009904 |
| Molecular Formula | C9H5Cl2NS |
| Molecular Weight | 230.12 g/mol |
| Exact Mass | 228.95 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-1,3-thiazole |
| SMILES | Clc1ccc(-c2cscn2)c(Cl)c1 |
| InChI | InChI=1S/C9H5Cl2NS/c10-6-1-2-7(8(11)3-6)9-4-13-5-12-9/h1-5H |
| InChIKey | KSGIKFJCCZIESB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.12 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |