C9H7FN2O2 — CID 137015317
2-(3-amino-1,2-oxazol-5-yl)-4-fluorophenol (PubChem CID 137015317) has the molecular formula C9H7FN2O2 and a molecular weight of 194.17 g/mol. Its IUPAC name is 2-(3-amino-1,2-oxazol-5-yl)-4-fluorophenol.
| Compound Name | 2-(3-amino-1,2-oxazol-5-yl)-4-fluorophenol |
|---|---|
| PubChem CID | 137015317 |
| Molecular Formula | C9H7FN2O2 |
| Molecular Weight | 194.17 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 2-(3-amino-1,2-oxazol-5-yl)-4-fluorophenol |
| SMILES | Nc1cc(-c2cc(F)ccc2O)on1 |
| InChI | InChI=1S/C9H7FN2O2/c10-5-1-2-7(13)6(3-5)8-4-9(11)12-14-8/h1-4,13H,(H2,11,12) |
| InChIKey | USCLYACYQJWSOT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.17 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |