C9H5ClF2N2O — CID 117333114
5-(2-chloro-3,5-difluorophenyl)-1,2-oxazol-3-amine (PubChem CID 117333114) has the molecular formula C9H5ClF2N2O and a molecular weight of 230.60 g/mol. Its IUPAC name is 5-(2-chloro-3,5-difluorophenyl)-1,2-oxazol-3-amine.
| Compound Name | 5-(2-chloro-3,5-difluorophenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117333114 |
| Molecular Formula | C9H5ClF2N2O |
| Molecular Weight | 230.60 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | 5-(2-chloro-3,5-difluorophenyl)-1,2-oxazol-3-amine |
| SMILES | Nc1cc(-c2cc(F)cc(F)c2Cl)on1 |
| InChI | InChI=1S/C9H5ClF2N2O/c10-9-5(1-4(11)2-6(9)12)7-3-8(13)14-15-7/h1-3H,(H2,13,14) |
| InChIKey | ONMRAKXZGANCJH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.60 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|