C10H7FN2O3 — CID 117317439
5-(6-fluoro-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine (PubChem CID 117317439) has the molecular formula C10H7FN2O3 and a molecular weight of 222.18 g/mol. Its IUPAC name is 5-(6-fluoro-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine.
| Compound Name | 5-(6-fluoro-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117317439 |
| Molecular Formula | C10H7FN2O3 |
| Molecular Weight | 222.18 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 5-(6-fluoro-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine |
| SMILES | Nc1cc(-c2cc3c(cc2F)OCO3)on1 |
| InChI | InChI=1S/C10H7FN2O3/c11-6-2-9-8(14-4-15-9)1-5(6)7-3-10(12)13-16-7/h1-3H,4H2,(H2,12,13) |
| InChIKey | OGXCIZBVPOAOSL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.18 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |