C12H12N2O3 — CID 117335995
5-(6-ethyl-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine (PubChem CID 117335995) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 5-(6-ethyl-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine.
| Compound Name | 5-(6-ethyl-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117335995 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 5-(6-ethyl-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine |
| SMILES | CCc1cc2c(cc1-c1cc(N)no1)OCO2 |
| InChI | InChI=1S/C12H12N2O3/c1-2-7-3-10-11(16-6-15-10)4-8(7)9-5-12(13)14-17-9/h3-5H,2,6H2,1H3,(H2,13,14) |
| InChIKey | QVSKOUVQOWXIIE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |