C11H11BrN2O — CID 117420990
5-(4-bromo-2-ethylphenyl)-1,2-oxazol-3-amine (PubChem CID 117420990) has the molecular formula C11H11BrN2O and a molecular weight of 267.13 g/mol. Its IUPAC name is 5-(4-bromo-2-ethylphenyl)-1,2-oxazol-3-amine.
| Compound Name | 5-(4-bromo-2-ethylphenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117420990 |
| Molecular Formula | C11H11BrN2O |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 5-(4-bromo-2-ethylphenyl)-1,2-oxazol-3-amine |
| SMILES | CCc1cc(Br)ccc1-c1cc(N)no1 |
| InChI | InChI=1S/C11H11BrN2O/c1-2-7-5-8(12)3-4-9(7)10-6-11(13)14-15-10/h3-6H,2H2,1H3,(H2,13,14) |
| InChIKey | KGRYPBVULTWUSI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |