C11H12FN3O — CID 115111733
5-[2-(dimethylamino)-3-fluorophenyl]-1,2-oxazol-3-amine (PubChem CID 115111733) has the molecular formula C11H12FN3O and a molecular weight of 221.24 g/mol. Its IUPAC name is 5-[2-(dimethylamino)-3-fluorophenyl]-1,2-oxazol-3-amine.
| Compound Name | 5-[2-(dimethylamino)-3-fluorophenyl]-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 115111733 |
| Molecular Formula | C11H12FN3O |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 5-[2-(dimethylamino)-3-fluorophenyl]-1,2-oxazol-3-amine |
| SMILES | CN(C)c1c(F)cccc1-c1cc(N)no1 |
| InChI | InChI=1S/C11H12FN3O/c1-15(2)11-7(4-3-5-8(11)12)9-6-10(13)14-16-9/h3-6H,1-2H3,(H2,13,14) |
| InChIKey | DOVDQXMLDULMFE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |