C11H11F2N3O — CID 115111734
5-[2-(dimethylamino)-3,6-difluorophenyl]-1,2-oxazol-3-amine (PubChem CID 115111734) has the molecular formula C11H11F2N3O and a molecular weight of 239.23 g/mol. Its IUPAC name is 5-[2-(dimethylamino)-3,6-difluorophenyl]-1,2-oxazol-3-amine.
| Compound Name | 5-[2-(dimethylamino)-3,6-difluorophenyl]-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 115111734 |
| Molecular Formula | C11H11F2N3O |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 5-[2-(dimethylamino)-3,6-difluorophenyl]-1,2-oxazol-3-amine |
| SMILES | CN(C)c1c(F)ccc(F)c1-c1cc(N)no1 |
| InChI | InChI=1S/C11H11F2N3O/c1-16(2)11-7(13)4-3-6(12)10(11)8-5-9(14)15-17-8/h3-5H,1-2H3,(H2,14,15) |
| InChIKey | BJJYBWAIJWKEMP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |