C10H9FN2OS — CID 117321679
5-(2-fluoro-6-methylsulfanylphenyl)-1,2-oxazol-3-amine (PubChem CID 117321679) has the molecular formula C10H9FN2OS and a molecular weight of 224.26 g/mol. Its IUPAC name is 5-(2-fluoro-6-methylsulfanylphenyl)-1,2-oxazol-3-amine.
| Compound Name | 5-(2-fluoro-6-methylsulfanylphenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117321679 |
| Molecular Formula | C10H9FN2OS |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 5-(2-fluoro-6-methylsulfanylphenyl)-1,2-oxazol-3-amine |
| SMILES | CSc1cccc(F)c1-c1cc(N)no1 |
| InChI | InChI=1S/C10H9FN2OS/c1-15-8-4-2-3-6(11)10(8)7-5-9(12)13-14-7/h2-5H,1H3,(H2,12,13) |
| InChIKey | SZTKDYXHJFPGEV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |