C11H6F2N2O2 — CID 117344153
5-(5,7-difluoro-1-benzofuran-4-yl)-1,2-oxazol-3-amine (PubChem CID 117344153) has the molecular formula C11H6F2N2O2 and a molecular weight of 236.18 g/mol. Its IUPAC name is 5-(5,7-difluoro-1-benzofuran-4-yl)-1,2-oxazol-3-amine.
| Compound Name | 5-(5,7-difluoro-1-benzofuran-4-yl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117344153 |
| Molecular Formula | C11H6F2N2O2 |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 5-(5,7-difluoro-1-benzofuran-4-yl)-1,2-oxazol-3-amine |
| SMILES | Nc1cc(-c2c(F)cc(F)c3occc23)on1 |
| InChI | InChI=1S/C11H6F2N2O2/c12-6-3-7(13)11-5(1-2-16-11)10(6)8-4-9(14)15-17-8/h1-4H,(H2,14,15) |
| InChIKey | JIROXADOMMFQAX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |