C11H10N2O3 — CID 137013109
6-(3-amino-1,2-oxazol-5-yl)-1,3-dihydro-2-benzofuran-5-ol (PubChem CID 137013109) has the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. Its IUPAC name is 6-(3-amino-1,2-oxazol-5-yl)-1,3-dihydro-2-benzofuran-5-ol.
| Compound Name | 6-(3-amino-1,2-oxazol-5-yl)-1,3-dihydro-2-benzofuran-5-ol |
|---|---|
| PubChem CID | 137013109 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 6-(3-amino-1,2-oxazol-5-yl)-1,3-dihydro-2-benzofuran-5-ol |
| SMILES | Nc1cc(-c2cc3c(cc2O)COC3)on1 |
| InChI | InChI=1S/C11H10N2O3/c12-11-3-10(16-13-11)8-1-6-4-15-5-7(6)2-9(8)14/h1-3,14H,4-5H2,(H2,12,13) |
| InChIKey | QVNLLBMVFROOLV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |