C13H14N2O — CID 117305645
5-(7-methyl-2,3-dihydro-1H-inden-4-yl)-1,2-oxazol-3-amine (PubChem CID 117305645) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is 5-(7-methyl-2,3-dihydro-1H-inden-4-yl)-1,2-oxazol-3-amine.
| Compound Name | 5-(7-methyl-2,3-dihydro-1H-inden-4-yl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117305645 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 5-(7-methyl-2,3-dihydro-1H-inden-4-yl)-1,2-oxazol-3-amine |
| SMILES | Cc1ccc(-c2cc(N)no2)c2c1CCC2 |
| InChI | InChI=1S/C13H14N2O/c1-8-5-6-11(10-4-2-3-9(8)10)12-7-13(14)15-16-12/h5-7H,2-4H2,1H3,(H2,14,15) |
| InChIKey | QZZQQYRFCOSJJZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |