C12H9N3O2 — CID 136968536
5-(3-amino-1,2-oxazol-5-yl)quinolin-8-ol (PubChem CID 136968536) has the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. Its IUPAC name is 5-(3-amino-1,2-oxazol-5-yl)quinolin-8-ol.
| Compound Name | 5-(3-amino-1,2-oxazol-5-yl)quinolin-8-ol |
|---|---|
| PubChem CID | 136968536 |
| Molecular Formula | C12H9N3O2 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 5-(3-amino-1,2-oxazol-5-yl)quinolin-8-ol |
| SMILES | Nc1cc(-c2ccc(O)c3ncccc23)on1 |
| InChI | InChI=1S/C12H9N3O2/c13-11-6-10(17-15-11)7-3-4-9(16)12-8(7)2-1-5-14-12/h1-6,16H,(H2,13,15) |
| InChIKey | AOTDDPVMTRUSEY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |