About CID 6367063
CID 6367063 (PubChem CID 6367063) has the molecular formula C9H10BiClNO3
and a molecular weight of 424.62 g/mol.
Molecular Properties
| Compound Name | CID 6367063 |
| PubChem CID | 6367063 |
| Molecular Formula | C9H10BiClNO3 |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | — |
| SMILES | O.O.Oc1ccc(Cl)c2cccnc12.[Bi] |
| InChI | InChI=1S/C9H6ClNO.Bi.2H2O/c10-7-3-4-8(12)9-6(7)2-1-5-11-9;;;/h1-5,12H;;2*1H2 |
| InChIKey | JVAQUDRZFNYXQA-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 96.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 6367063 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 6367063?
The IUPAC name of CID 6367063 (CID 6367063) is not available.
What is the SMILES notation for CID 6367063?
The canonical SMILES for CID 6367063 is O.O.Oc1ccc(Cl)c2cccnc12.[Bi].
What is the InChIKey of CID 6367063?
The InChIKey is JVAQUDRZFNYXQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClNO.Bi.2H2O/c10-7-3-4-8(12)9-6(7)2-1-5-11-9;;;/h1-5,12H;;2*1H2.
What are the key properties of CID 6367063?
CID 6367063 has a molecular weight of 424.62 g/mol, XLogP of 0.56, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 6367063 is sourced from PubChem (CID 6367063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).