About CID 12945983
CID 12945983 (PubChem CID 12945983) has the molecular formula C9H5BClNO
and a molecular weight of 189.41 g/mol.
Molecular Properties
| Compound Name | CID 12945983 |
| PubChem CID | 12945983 |
| Molecular Formula | C9H5BClNO |
| Molecular Weight | 189.41 g/mol |
| Exact Mass | 189.02 |
| IUPAC Name | — |
| SMILES | [B]Oc1ccc(Cl)c2cccnc12 |
| InChI | InChI=1S/C9H5BClNO/c10-13-8-4-3-7(11)6-2-1-5-12-9(6)8/h1-5H |
| InChIKey | LMSIUUNSVUZNLB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 12945983 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 12945983?
The IUPAC name of CID 12945983 (CID 12945983) is not available.
What is the SMILES notation for CID 12945983?
The canonical SMILES for CID 12945983 is [B]Oc1ccc(Cl)c2cccnc12.
What is the InChIKey of CID 12945983?
The InChIKey is LMSIUUNSVUZNLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BClNO/c10-13-8-4-3-7(11)6-2-1-5-12-9(6)8/h1-5H.
What are the key properties of CID 12945983?
CID 12945983 has a molecular weight of 189.41 g/mol, XLogP of 2.35, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 12945983 is sourced from PubChem (CID 12945983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).