C15H8Cl3NO3S — CID 91669666
(5-chloroquinolin-8-yl) 3,4-dichlorobenzenesulfonate (PubChem CID 91669666) has the molecular formula C15H8Cl3NO3S and a molecular weight of 388.66 g/mol. Its IUPAC name is (5-chloroquinolin-8-yl) 3,4-dichlorobenzenesulfonate.
| Compound Name | (5-chloroquinolin-8-yl) 3,4-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 91669666 |
| Molecular Formula | C15H8Cl3NO3S |
| Molecular Weight | 388.66 g/mol |
| Exact Mass | 386.93 |
| IUPAC Name | (5-chloroquinolin-8-yl) 3,4-dichlorobenzenesulfonate |
| SMILES | O=S(=O)(Oc1ccc(Cl)c2cccnc12)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H8Cl3NO3S/c16-11-5-6-14(15-10(11)2-1-7-19-15)22-23(20,21)9-3-4-12(17)13(18)8-9/h1-8H |
| InChIKey | IVJBLUKKJSQIQU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.66 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|