C17H11Cl2NO4S — CID 24656910
(4-pyridin-2-yloxyphenyl) 3,4-dichlorobenzenesulfonate (PubChem CID 24656910) has the molecular formula C17H11Cl2NO4S and a molecular weight of 396.25 g/mol. Its IUPAC name is (4-pyridin-2-yloxyphenyl) 3,4-dichlorobenzenesulfonate.
| Compound Name | (4-pyridin-2-yloxyphenyl) 3,4-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 24656910 |
| Molecular Formula | C17H11Cl2NO4S |
| Molecular Weight | 396.25 g/mol |
| Exact Mass | 394.98 |
| IUPAC Name | (4-pyridin-2-yloxyphenyl) 3,4-dichlorobenzenesulfonate |
| SMILES | O=S(=O)(Oc1ccc(Oc2ccccn2)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H11Cl2NO4S/c18-15-9-8-14(11-16(15)19)25(21,22)24-13-6-4-12(5-7-13)23-17-3-1-2-10-20-17/h1-11H |
| InChIKey | RUJMPSRUXYJYKO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.25 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|