About ethane;2-phenoxypyridine
ethane;2-phenoxypyridine (PubChem CID 90835857) has the molecular formula C15H21NO
and a molecular weight of 231.34 g/mol. Its IUPAC name is ethane;2-phenoxypyridine.
Molecular Properties
| Compound Name | ethane;2-phenoxypyridine |
| PubChem CID | 90835857 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | ethane;2-phenoxypyridine |
| SMILES | CC.CC.c1ccc(Oc2ccccn2)cc1 |
| InChI | InChI=1S/C11H9NO.2C2H6/c1-2-6-10(7-3-1)13-11-8-4-5-9-12-11;2*1-2/h1-9H;2*1-2H3 |
| InChIKey | YSKUZILMCBICEB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-phenoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-phenoxypyridine?
The IUPAC name of ethane;2-phenoxypyridine (CID 90835857) is ethane;2-phenoxypyridine.
What is the SMILES notation for ethane;2-phenoxypyridine?
The canonical SMILES for ethane;2-phenoxypyridine is CC.CC.c1ccc(Oc2ccccn2)cc1.
What is the InChIKey of ethane;2-phenoxypyridine?
The InChIKey is YSKUZILMCBICEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO.2C2H6/c1-2-6-10(7-3-1)13-11-8-4-5-9-12-11;2*1-2/h1-9H;2*1-2H3.
What are the key properties of ethane;2-phenoxypyridine?
ethane;2-phenoxypyridine has a molecular weight of 231.34 g/mol, XLogP of 4.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-phenoxypyridine is sourced from PubChem (CID 90835857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).