About N-hydroxyethanimidoyl chloride;2-phenoxypyridine
N-hydroxyethanimidoyl chloride;2-phenoxypyridine (PubChem CID 86612460) has the molecular formula C13H13ClN2O2
and a molecular weight of 264.71 g/mol. Its IUPAC name is N-hydroxyethanimidoyl chloride;2-phenoxypyridine.
Molecular Properties
| Compound Name | N-hydroxyethanimidoyl chloride;2-phenoxypyridine |
| PubChem CID | 86612460 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | N-hydroxyethanimidoyl chloride;2-phenoxypyridine |
| SMILES | CC(Cl)=NO.c1ccc(Oc2ccccn2)cc1 |
| InChI | InChI=1S/C11H9NO.C2H4ClNO/c1-2-6-10(7-3-1)13-11-8-4-5-9-12-11;1-2(3)4-5/h1-9H;5H,1H3 |
| InChIKey | SPDNHDAOWFBLCU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxyethanimidoyl chloride;2-phenoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxyethanimidoyl chloride;2-phenoxypyridine?
The IUPAC name of N-hydroxyethanimidoyl chloride;2-phenoxypyridine (CID 86612460) is N-hydroxyethanimidoyl chloride;2-phenoxypyridine.
What is the SMILES notation for N-hydroxyethanimidoyl chloride;2-phenoxypyridine?
The canonical SMILES for N-hydroxyethanimidoyl chloride;2-phenoxypyridine is CC(Cl)=NO.c1ccc(Oc2ccccn2)cc1.
What is the InChIKey of N-hydroxyethanimidoyl chloride;2-phenoxypyridine?
The InChIKey is SPDNHDAOWFBLCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO.C2H4ClNO/c1-2-6-10(7-3-1)13-11-8-4-5-9-12-11;1-2(3)4-5/h1-9H;5H,1H3.
What are the key properties of N-hydroxyethanimidoyl chloride;2-phenoxypyridine?
N-hydroxyethanimidoyl chloride;2-phenoxypyridine has a molecular weight of 264.71 g/mol, XLogP of 3.91, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxyethanimidoyl chloride;2-phenoxypyridine is sourced from PubChem (CID 86612460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).