C19H14N2O4 — CID 67475111
1-[6-(3-pyridin-2-yloxyphenoxy)-2-pyridinyl]propane-1,2-dione (PubChem CID 67475111) has the molecular formula C19H14N2O4 and a molecular weight of 334.33 g/mol. Its IUPAC name is 1-[6-(3-pyridin-2-yloxyphenoxy)-2-pyridinyl]propane-1,2-dione.
| Compound Name | 1-[6-(3-pyridin-2-yloxyphenoxy)-2-pyridinyl]propane-1,2-dione |
|---|---|
| PubChem CID | 67475111 |
| Molecular Formula | C19H14N2O4 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 1-[6-(3-pyridin-2-yloxyphenoxy)-2-pyridinyl]propane-1,2-dione |
| SMILES | CC(=O)C(=O)c1cccc(Oc2cccc(Oc3ccccn3)c2)n1 |
| InChI | InChI=1S/C19H14N2O4/c1-13(22)19(23)16-8-5-10-18(21-16)25-15-7-4-6-14(12-15)24-17-9-2-3-11-20-17/h2-12H,1H3 |
| InChIKey | DCJIHNWKMNLYBU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|