About phenoxybenzene;2-pyridin-2-ylpyridine
phenoxybenzene;2-pyridin-2-ylpyridine (PubChem CID 174917355) has the molecular formula C22H18N2O
and a molecular weight of 326.40 g/mol. Its IUPAC name is phenoxybenzene;2-pyridin-2-ylpyridine.
Molecular Properties
| Compound Name | phenoxybenzene;2-pyridin-2-ylpyridine |
| PubChem CID | 174917355 |
| Molecular Formula | C22H18N2O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | phenoxybenzene;2-pyridin-2-ylpyridine |
| SMILES | c1ccc(-c2ccccn2)nc1.c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.C10H8N2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-7-11-9(5-1)10-6-2-4-8-12-10/h1-10H;1-8H |
| InChIKey | OPQYJCYHCBVUBZ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenoxybenzene;2-pyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenoxybenzene;2-pyridin-2-ylpyridine?
The IUPAC name of phenoxybenzene;2-pyridin-2-ylpyridine (CID 174917355) is phenoxybenzene;2-pyridin-2-ylpyridine.
What is the SMILES notation for phenoxybenzene;2-pyridin-2-ylpyridine?
The canonical SMILES for phenoxybenzene;2-pyridin-2-ylpyridine is c1ccc(-c2ccccn2)nc1.c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of phenoxybenzene;2-pyridin-2-ylpyridine?
The InChIKey is OPQYJCYHCBVUBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.C10H8N2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-7-11-9(5-1)10-6-2-4-8-12-10/h1-10H;1-8H.
What are the key properties of phenoxybenzene;2-pyridin-2-ylpyridine?
phenoxybenzene;2-pyridin-2-ylpyridine has a molecular weight of 326.40 g/mol, XLogP of 5.62, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenoxybenzene;2-pyridin-2-ylpyridine is sourced from PubChem (CID 174917355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).