About (5-chloroquinolin-8-yl) morpholine-4-sulfonate
(5-chloroquinolin-8-yl) morpholine-4-sulfonate (PubChem CID 11841630) has the molecular formula C13H13ClN2O4S
and a molecular weight of 328.78 g/mol. Its IUPAC name is (5-chloroquinolin-8-yl) morpholine-4-sulfonate.
Molecular Properties
| Compound Name | (5-chloroquinolin-8-yl) morpholine-4-sulfonate |
| PubChem CID | 11841630 |
| Molecular Formula | C13H13ClN2O4S |
| Molecular Weight | 328.78 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | (5-chloroquinolin-8-yl) morpholine-4-sulfonate |
| SMILES | O=S(=O)(Oc1ccc(Cl)c2cccnc12)N1CCOCC1 |
| InChI | InChI=1S/C13H13ClN2O4S/c14-11-3-4-12(13-10(11)2-1-5-15-13)20-21(17,18)16-6-8-19-9-7-16/h1-5H,6-9H2 |
| InChIKey | PDHQFXCODPYFMN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.78 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-chloroquinolin-8-yl) morpholine-4-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloroquinolin-8-yl) morpholine-4-sulfonate?
The IUPAC name of (5-chloroquinolin-8-yl) morpholine-4-sulfonate (CID 11841630) is (5-chloroquinolin-8-yl) morpholine-4-sulfonate.
What is the SMILES notation for (5-chloroquinolin-8-yl) morpholine-4-sulfonate?
The canonical SMILES for (5-chloroquinolin-8-yl) morpholine-4-sulfonate is O=S(=O)(Oc1ccc(Cl)c2cccnc12)N1CCOCC1.
What is the InChIKey of (5-chloroquinolin-8-yl) morpholine-4-sulfonate?
The InChIKey is PDHQFXCODPYFMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClN2O4S/c14-11-3-4-12(13-10(11)2-1-5-15-13)20-21(17,18)16-6-8-19-9-7-16/h1-5H,6-9H2.
What are the key properties of (5-chloroquinolin-8-yl) morpholine-4-sulfonate?
(5-chloroquinolin-8-yl) morpholine-4-sulfonate has a molecular weight of 328.78 g/mol, XLogP of 1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloroquinolin-8-yl) morpholine-4-sulfonate is sourced from PubChem (CID 11841630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).