About potassium;5-chloroquinolin-8-ol;hydride
potassium;5-chloroquinolin-8-ol;hydride (PubChem CID 174478922) has the molecular formula C9H7ClKNO
and a molecular weight of 219.71 g/mol. Its IUPAC name is potassium;5-chloroquinolin-8-ol;hydride.
Molecular Properties
| Compound Name | potassium;5-chloroquinolin-8-ol;hydride |
| PubChem CID | 174478922 |
| Molecular Formula | C9H7ClKNO |
| Molecular Weight | 219.71 g/mol |
| Exact Mass | 218.99 |
| IUPAC Name | potassium;5-chloroquinolin-8-ol;hydride |
| SMILES | Oc1ccc(Cl)c2cccnc12.[H-].[K+] |
| InChI | InChI=1S/C9H6ClNO.K.H/c10-7-3-4-8(12)9-6(7)2-1-5-11-9;;/h1-5,12H;;/q;+1;-1 |
| InChIKey | PXANZKIIPNRSSH-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.71 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium;5-chloroquinolin-8-ol;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;5-chloroquinolin-8-ol;hydride?
The IUPAC name of potassium;5-chloroquinolin-8-ol;hydride (CID 174478922) is potassium;5-chloroquinolin-8-ol;hydride.
What is the SMILES notation for potassium;5-chloroquinolin-8-ol;hydride?
The canonical SMILES for potassium;5-chloroquinolin-8-ol;hydride is Oc1ccc(Cl)c2cccnc12.[H-].[K+].
What is the InChIKey of potassium;5-chloroquinolin-8-ol;hydride?
The InChIKey is PXANZKIIPNRSSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClNO.K.H/c10-7-3-4-8(12)9-6(7)2-1-5-11-9;;/h1-5,12H;;/q;+1;-1.
What are the key properties of potassium;5-chloroquinolin-8-ol;hydride?
potassium;5-chloroquinolin-8-ol;hydride has a molecular weight of 219.71 g/mol, XLogP of -0.29, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;5-chloroquinolin-8-ol;hydride is sourced from PubChem (CID 174478922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).