C11H8ClF2NO — CID 112618208
1-(5-chloroquinolin-8-yl)-2,2-difluoroethanol (PubChem CID 112618208) has the molecular formula C11H8ClF2NO and a molecular weight of 243.64 g/mol. Its IUPAC name is 1-(5-chloroquinolin-8-yl)-2,2-difluoroethanol.
| Compound Name | 1-(5-chloroquinolin-8-yl)-2,2-difluoroethanol |
|---|---|
| PubChem CID | 112618208 |
| Molecular Formula | C11H8ClF2NO |
| Molecular Weight | 243.64 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 1-(5-chloroquinolin-8-yl)-2,2-difluoroethanol |
| SMILES | OC(c1ccc(Cl)c2cccnc12)C(F)F |
| InChI | InChI=1S/C11H8ClF2NO/c12-8-4-3-7(10(16)11(13)14)9-6(8)2-1-5-15-9/h1-5,10-11,16H |
| InChIKey | FELPBTHBATUMPW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.64 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |