C13H13ClF2N2O — CID 103766069
3-[(5-chloroquinolin-8-yl)methylamino]-1,1-difluoropropan-2-ol (PubChem CID 103766069) has the molecular formula C13H13ClF2N2O and a molecular weight of 286.71 g/mol. Its IUPAC name is 3-[(5-chloroquinolin-8-yl)methylamino]-1,1-difluoropropan-2-ol.
| Compound Name | 3-[(5-chloroquinolin-8-yl)methylamino]-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 103766069 |
| Molecular Formula | C13H13ClF2N2O |
| Molecular Weight | 286.71 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 3-[(5-chloroquinolin-8-yl)methylamino]-1,1-difluoropropan-2-ol |
| SMILES | OC(CNCc1ccc(Cl)c2cccnc12)C(F)F |
| InChI | InChI=1S/C13H13ClF2N2O/c14-10-4-3-8(6-17-7-11(19)13(15)16)12-9(10)2-1-5-18-12/h1-5,11,13,17,19H,6-7H2 |
| InChIKey | LVTVULXAEISIGF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.71 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |