C15H18ClN3O — CID 103765788
3-[(5-chloroquinolin-8-yl)methylamino]-2,2-dimethylpropanamide (PubChem CID 103765788) has the molecular formula C15H18ClN3O and a molecular weight of 291.78 g/mol. Its IUPAC name is 3-[(5-chloroquinolin-8-yl)methylamino]-2,2-dimethylpropanamide.
| Compound Name | 3-[(5-chloroquinolin-8-yl)methylamino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 103765788 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 3-[(5-chloroquinolin-8-yl)methylamino]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CNCc1ccc(Cl)c2cccnc12)C(N)=O |
| InChI | InChI=1S/C15H18ClN3O/c1-15(2,14(17)20)9-18-8-10-5-6-12(16)11-4-3-7-19-13(10)11/h3-7,18H,8-9H2,1-2H3,(H2,17,20) |
| InChIKey | RGEVJBZHTLYNSS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |