C14H14ClF3N2 — CID 115697579
N-[(5-chloroquinolin-8-yl)methyl]-4,4,4-trifluorobutan-1-amine (PubChem CID 115697579) has the molecular formula C14H14ClF3N2 and a molecular weight of 302.73 g/mol. Its IUPAC name is N-[(5-chloroquinolin-8-yl)methyl]-4,4,4-trifluorobutan-1-amine.
| Compound Name | N-[(5-chloroquinolin-8-yl)methyl]-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 115697579 |
| Molecular Formula | C14H14ClF3N2 |
| Molecular Weight | 302.73 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | N-[(5-chloroquinolin-8-yl)methyl]-4,4,4-trifluorobutan-1-amine |
| SMILES | FC(F)(F)CCCNCc1ccc(Cl)c2cccnc12 |
| InChI | InChI=1S/C14H14ClF3N2/c15-12-5-4-10(13-11(12)3-1-8-20-13)9-19-7-2-6-14(16,17)18/h1,3-5,8,19H,2,6-7,9H2 |
| InChIKey | UDZAMYPWAQSTER-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.73 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|