C15H21Cl3N2O2S — CID 154864755
N-[(5-chloroquinolin-8-yl)methyl]-3-ethylsulfonylpropan-1-amine;dihydrochloride (PubChem CID 154864755) has the molecular formula C15H21Cl3N2O2S and a molecular weight of 399.77 g/mol. Its IUPAC name is N-[(5-chloroquinolin-8-yl)methyl]-3-ethylsulfonylpropan-1-amine;dihydrochloride.
| Compound Name | N-[(5-chloroquinolin-8-yl)methyl]-3-ethylsulfonylpropan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 154864755 |
| Molecular Formula | C15H21Cl3N2O2S |
| Molecular Weight | 399.77 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | N-[(5-chloroquinolin-8-yl)methyl]-3-ethylsulfonylpropan-1-amine;dihydrochloride |
| SMILES | CCS(=O)(=O)CCCNCc1ccc(Cl)c2cccnc12.Cl.Cl |
| InChI | InChI=1S/C15H19ClN2O2S.2ClH/c1-2-21(19,20)10-4-8-17-11-12-6-7-14(16)13-5-3-9-18-15(12)13;;/h3,5-7,9,17H,2,4,8,10-11H2,1H3;2*1H |
| InChIKey | UMOVRCVEHSSOIX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.77 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|