C11H8ClF3N2O2S — CID 114827717
1-(5-chloroquinolin-8-yl)-2,2,2-trifluoroethanesulfonamide (PubChem CID 114827717) has the molecular formula C11H8ClF3N2O2S and a molecular weight of 324.71 g/mol. Its IUPAC name is 1-(5-chloroquinolin-8-yl)-2,2,2-trifluoroethanesulfonamide.
| Compound Name | 1-(5-chloroquinolin-8-yl)-2,2,2-trifluoroethanesulfonamide |
|---|---|
| PubChem CID | 114827717 |
| Molecular Formula | C11H8ClF3N2O2S |
| Molecular Weight | 324.71 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 1-(5-chloroquinolin-8-yl)-2,2,2-trifluoroethanesulfonamide |
| SMILES | NS(=O)(=O)C(c1ccc(Cl)c2cccnc12)C(F)(F)F |
| InChI | InChI=1S/C11H8ClF3N2O2S/c12-8-4-3-7(9-6(8)2-1-5-17-9)10(11(13,14)15)20(16,18)19/h1-5,10H,(H2,16,18,19) |
| InChIKey | JGWIJPILSVGBNI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.71 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |