About calcium;5-chloroquinolin-8-ol;hydride
calcium;5-chloroquinolin-8-ol;hydride (PubChem CID 174353815) has the molecular formula C9H8CaClNO
and a molecular weight of 221.70 g/mol. Its IUPAC name is calcium;5-chloroquinolin-8-ol;hydride.
Molecular Properties
| Compound Name | calcium;5-chloroquinolin-8-ol;hydride |
| PubChem CID | 174353815 |
| Molecular Formula | C9H8CaClNO |
| Molecular Weight | 221.70 g/mol |
| Exact Mass | 220.99 |
| IUPAC Name | calcium;5-chloroquinolin-8-ol;hydride |
| SMILES | Oc1ccc(Cl)c2cccnc12.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C9H6ClNO.Ca.2H/c10-7-3-4-8(12)9-6(7)2-1-5-11-9;;;/h1-5,12H;;;/q;+2;2*-1 |
| InChIKey | NUNDYVBGJJLZMM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.70 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze calcium;5-chloroquinolin-8-ol;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;5-chloroquinolin-8-ol;hydride?
The IUPAC name of calcium;5-chloroquinolin-8-ol;hydride (CID 174353815) is calcium;5-chloroquinolin-8-ol;hydride.
What is the SMILES notation for calcium;5-chloroquinolin-8-ol;hydride?
The canonical SMILES for calcium;5-chloroquinolin-8-ol;hydride is Oc1ccc(Cl)c2cccnc12.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;5-chloroquinolin-8-ol;hydride?
The InChIKey is NUNDYVBGJJLZMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClNO.Ca.2H/c10-7-3-4-8(12)9-6(7)2-1-5-11-9;;;/h1-5,12H;;;/q;+2;2*-1.
What are the key properties of calcium;5-chloroquinolin-8-ol;hydride?
calcium;5-chloroquinolin-8-ol;hydride has a molecular weight of 221.70 g/mol, XLogP of 2.44, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;5-chloroquinolin-8-ol;hydride is sourced from PubChem (CID 174353815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).