About 5-bromoquinolin-8-ol;nickel
5-bromoquinolin-8-ol;nickel (PubChem CID 175092761) has the molecular formula C9H6BrNNiO
and a molecular weight of 282.75 g/mol. Its IUPAC name is 5-bromoquinolin-8-ol;nickel.
Molecular Properties
| Compound Name | 5-bromoquinolin-8-ol;nickel |
| PubChem CID | 175092761 |
| Molecular Formula | C9H6BrNNiO |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 280.90 |
| IUPAC Name | 5-bromoquinolin-8-ol;nickel |
| SMILES | Oc1ccc(Br)c2cccnc12.[Ni] |
| InChI | InChI=1S/C9H6BrNO.Ni/c10-7-3-4-8(12)9-6(7)2-1-5-11-9;/h1-5,12H; |
| InChIKey | XXPPDGQCROEZEZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromoquinolin-8-ol;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromoquinolin-8-ol;nickel?
The IUPAC name of 5-bromoquinolin-8-ol;nickel (CID 175092761) is 5-bromoquinolin-8-ol;nickel.
What is the SMILES notation for 5-bromoquinolin-8-ol;nickel?
The canonical SMILES for 5-bromoquinolin-8-ol;nickel is Oc1ccc(Br)c2cccnc12.[Ni].
What is the InChIKey of 5-bromoquinolin-8-ol;nickel?
The InChIKey is XXPPDGQCROEZEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrNO.Ni/c10-7-3-4-8(12)9-6(7)2-1-5-11-9;/h1-5,12H;.
What are the key properties of 5-bromoquinolin-8-ol;nickel?
5-bromoquinolin-8-ol;nickel has a molecular weight of 282.75 g/mol, XLogP of 2.70, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromoquinolin-8-ol;nickel is sourced from PubChem (CID 175092761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).