C12H6BrF6NO — CID 121303156
2-(5-bromoquinolin-8-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 121303156) has the molecular formula C12H6BrF6NO and a molecular weight of 374.08 g/mol. Its IUPAC name is 2-(5-bromoquinolin-8-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(5-bromoquinolin-8-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 121303156 |
| Molecular Formula | C12H6BrF6NO |
| Molecular Weight | 374.08 g/mol |
| Exact Mass | 372.95 |
| IUPAC Name | 2-(5-bromoquinolin-8-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(c1ccc(Br)c2cccnc12)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H6BrF6NO/c13-8-4-3-7(9-6(8)2-1-5-20-9)10(21,11(14,15)16)12(17,18)19/h1-5,21H |
| InChIKey | NJJBPFQKJLUXMG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.08 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |