C13H13BrF2N2O — CID 104857696
3-[(5-bromoquinolin-8-yl)methylamino]-2,2-difluoropropan-1-ol (PubChem CID 104857696) has the molecular formula C13H13BrF2N2O and a molecular weight of 331.16 g/mol. Its IUPAC name is 3-[(5-bromoquinolin-8-yl)methylamino]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[(5-bromoquinolin-8-yl)methylamino]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 104857696 |
| Molecular Formula | C13H13BrF2N2O |
| Molecular Weight | 331.16 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 3-[(5-bromoquinolin-8-yl)methylamino]-2,2-difluoropropan-1-ol |
| SMILES | OCC(F)(F)CNCc1ccc(Br)c2cccnc12 |
| InChI | InChI=1S/C13H13BrF2N2O/c14-11-4-3-9(6-17-7-13(15,16)8-19)12-10(11)2-1-5-18-12/h1-5,17,19H,6-8H2 |
| InChIKey | XIJROYQSYJMSHO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.16 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |