C8H4F7NO — CID 133060408
1,1,1,3,3,3-hexafluoro-2-(2-fluoro-3-pyridinyl)propan-2-ol (PubChem CID 133060408) has the molecular formula C8H4F7NO and a molecular weight of 263.11 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(2-fluoro-3-pyridinyl)propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(2-fluoro-3-pyridinyl)propan-2-ol |
|---|---|
| PubChem CID | 133060408 |
| Molecular Formula | C8H4F7NO |
| Molecular Weight | 263.11 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(2-fluoro-3-pyridinyl)propan-2-ol |
| SMILES | OC(c1cccnc1F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H4F7NO/c9-5-4(2-1-3-16-5)6(17,7(10,11)12)8(13,14)15/h1-3,17H |
| InChIKey | TVZJOEYIQUFGRM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.11 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|