C12H9F6N3 — CID 159042611
4,5-difluorobenzene-1,2-diamine;2-fluoro-3-(trifluoromethyl)pyridine (PubChem CID 159042611) has the molecular formula C12H9F6N3 and a molecular weight of 309.21 g/mol. Its IUPAC name is 4,5-difluorobenzene-1,2-diamine;2-fluoro-3-(trifluoromethyl)pyridine.
| Compound Name | 4,5-difluorobenzene-1,2-diamine;2-fluoro-3-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 159042611 |
| Molecular Formula | C12H9F6N3 |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 4,5-difluorobenzene-1,2-diamine;2-fluoro-3-(trifluoromethyl)pyridine |
| SMILES | Fc1ncccc1C(F)(F)F.Nc1cc(F)c(F)cc1N |
| InChI | InChI=1S/C6H3F4N.C6H6F2N2/c7-5-4(6(8,9)10)2-1-3-11-5;7-3-1-5(9)6(10)2-4(3)8/h1-3H;1-2H,9-10H2 |
| InChIKey | JWGIMOFHWRBWCT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|